C33H35NO5 — CID 10602182
(2R,3R,4R,5E)-1,3,4-tris(phenylmethoxy)-5-phenylmethoxyiminopentan-2-ol (PubChem CID 10602182) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is (2R,3R,4R,5E)-1,3,4-tris(phenylmethoxy)-5-phenylmethoxyiminopentan-2-ol.
| Compound Name | (2R,3R,4R,5E)-1,3,4-tris(phenylmethoxy)-5-phenylmethoxyiminopentan-2-ol |
|---|---|
| PubChem CID | 10602182 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (2R,3R,4R,5E)-1,3,4-tris(phenylmethoxy)-5-phenylmethoxyiminopentan-2-ol |
| SMILES | O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](/C=N/OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO5/c35-31(26-36-22-27-13-5-1-6-14-27)33(38-24-29-17-9-3-10-18-29)32(37-23-28-15-7-2-8-16-28)21-34-39-25-30-19-11-4-12-20-30/h1-21,31-33,35H,22-26H2/b34-21+/t31-,32-,33-/m1/s1 |
| InChIKey | ONEAXZQMRACUEG-IVUKEQQFSA-N |
| XLogP | 5.94 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|