C40H42O4S2 — CID 10580114
(2R,3S,4R)-5,5-bis(benzylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 10580114) has the molecular formula C40H42O4S2 and a molecular weight of 650.91 g/mol. Its IUPAC name is (2R,3S,4R)-5,5-bis(benzylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2R,3S,4R)-5,5-bis(benzylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 10580114 |
| Molecular Formula | C40H42O4S2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | (2R,3S,4R)-5,5-bis(benzylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | O[C@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C40H42O4S2/c41-37(29-42-26-32-16-6-1-7-17-32)38(43-27-33-18-8-2-9-19-33)39(44-28-34-20-10-3-11-21-34)40(45-30-35-22-12-4-13-23-35)46-31-36-24-14-5-15-25-36/h1-25,37-41H,26-31H2/t37-,38+,39-/m1/s1 |
| InChIKey | XVAQPCSGOYVDDU-LIVPZPDMSA-N |
| XLogP | 8.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|