C25H40O4Si2 — CID 134878735
[(2R,4S)-1,5-bis(phenylmethoxy)-4-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane (PubChem CID 134878735) has the molecular formula C25H40O4Si2 and a molecular weight of 460.76 g/mol. Its IUPAC name is [(2R,4S)-1,5-bis(phenylmethoxy)-4-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane.
| Compound Name | [(2R,4S)-1,5-bis(phenylmethoxy)-4-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134878735 |
| Molecular Formula | C25H40O4Si2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(2R,4S)-1,5-bis(phenylmethoxy)-4-trimethylsilyloxypentan-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@H](COCc1ccccc1)C[C@H](COCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H40O4Si2/c1-30(2,3)28-24(20-26-18-22-13-9-7-10-14-22)17-25(29-31(4,5)6)21-27-19-23-15-11-8-12-16-23/h7-16,24-25H,17-21H2,1-6H3/t24-,25+ |
| InChIKey | ZEJRQOVBOKACNH-PLQXJYEYSA-N |
| XLogP | 6.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|