C22H30OSi — CID 101162239
trimethyl-[(Z,4R)-4-methyl-1-phenyl-5-phenylmethoxypent-2-en-2-yl]silane (PubChem CID 101162239) has the molecular formula C22H30OSi and a molecular weight of 338.57 g/mol. Its IUPAC name is trimethyl-[(Z,4R)-4-methyl-1-phenyl-5-phenylmethoxypent-2-en-2-yl]silane.
| Compound Name | trimethyl-[(Z,4R)-4-methyl-1-phenyl-5-phenylmethoxypent-2-en-2-yl]silane |
|---|---|
| PubChem CID | 101162239 |
| Molecular Formula | C22H30OSi |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | trimethyl-[(Z,4R)-4-methyl-1-phenyl-5-phenylmethoxypent-2-en-2-yl]silane |
| SMILES | C[C@H](/C=C(/Cc1ccccc1)[Si](C)(C)C)COCc1ccccc1 |
| InChI | InChI=1S/C22H30OSi/c1-19(17-23-18-21-13-9-6-10-14-21)15-22(24(2,3)4)16-20-11-7-5-8-12-20/h5-15,19H,16-18H2,1-4H3/b22-15-/t19-/m1/s1 |
| InChIKey | OXZPZEMMVINNFJ-MLPWYGTASA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|