C13H17BrO — CID 135014115
[(E,2R)-5-bromo-2-methylpent-3-enoxy]methylbenzene (PubChem CID 135014115) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is [(E,2R)-5-bromo-2-methylpent-3-enoxy]methylbenzene.
| Compound Name | [(E,2R)-5-bromo-2-methylpent-3-enoxy]methylbenzene |
|---|---|
| PubChem CID | 135014115 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [(E,2R)-5-bromo-2-methylpent-3-enoxy]methylbenzene |
| SMILES | C[C@H](/C=C/CBr)COCc1ccccc1 |
| InChI | InChI=1S/C13H17BrO/c1-12(6-5-9-14)10-15-11-13-7-3-2-4-8-13/h2-8,12H,9-11H2,1H3/b6-5+/t12-/m1/s1 |
| InChIKey | ZMKRGNCJJHFIIZ-BTDICHCPSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|