C20H24O2 — CID 15043730
(Z,1R,5R)-5-methyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol (PubChem CID 15043730) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (Z,1R,5R)-5-methyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol.
| Compound Name | (Z,1R,5R)-5-methyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol |
|---|---|
| PubChem CID | 15043730 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (Z,1R,5R)-5-methyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol |
| SMILES | C[C@H](/C=C\C[C@@H](O)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-17(15-22-16-18-10-4-2-5-11-18)9-8-14-20(21)19-12-6-3-7-13-19/h2-13,17,20-21H,14-16H2,1H3/b9-8-/t17-,20-/m1/s1 |
| InChIKey | NMWMYONYPXUKQX-WSMAHZFNSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|