C17H18O — CID 11230156
(E)-1,5-diphenylpent-3-en-1-ol (PubChem CID 11230156) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (E)-1,5-diphenylpent-3-en-1-ol.
| Compound Name | (E)-1,5-diphenylpent-3-en-1-ol |
|---|---|
| PubChem CID | 11230156 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (E)-1,5-diphenylpent-3-en-1-ol |
| SMILES | OC(C/C=C/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-10,12-13,17-18H,11,14H2/b8-7+ |
| InChIKey | QYIWEIZVOKWTEG-BQYQJAHWSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|