C13H18O2 — CID 135057186
(Z,1S,6R)-1-phenylhept-3-ene-1,6-diol (PubChem CID 135057186) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (Z,1S,6R)-1-phenylhept-3-ene-1,6-diol.
| Compound Name | (Z,1S,6R)-1-phenylhept-3-ene-1,6-diol |
|---|---|
| PubChem CID | 135057186 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (Z,1S,6R)-1-phenylhept-3-ene-1,6-diol |
| SMILES | C[C@@H](O)C/C=C\C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-11(14)7-5-6-10-13(15)12-8-3-2-4-9-12/h2-6,8-9,11,13-15H,7,10H2,1H3/b6-5-/t11-,13+/m1/s1 |
| InChIKey | DOFQTASOXKSCJB-ANCZFUFASA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|