C20H22O — CID 162404587
(3E,6E)-7-(4-methylphenyl)-1-phenylhepta-3,6-dien-1-ol (PubChem CID 162404587) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3E,6E)-7-(4-methylphenyl)-1-phenylhepta-3,6-dien-1-ol.
| Compound Name | (3E,6E)-7-(4-methylphenyl)-1-phenylhepta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 162404587 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3E,6E)-7-(4-methylphenyl)-1-phenylhepta-3,6-dien-1-ol |
| SMILES | Cc1ccc(/C=C/C/C=C/CC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O/c1-17-13-15-18(16-14-17)9-5-2-3-8-12-20(21)19-10-6-4-7-11-19/h3-11,13-16,20-21H,2,12H2,1H3/b8-3+,9-5+ |
| InChIKey | LYDGNWMVXFJBNX-RWQQVSAMSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|