C10H11FO — CID 124567652
(E,1S)-4-fluoro-1-phenylbut-3-en-1-ol (PubChem CID 124567652) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is (E,1S)-4-fluoro-1-phenylbut-3-en-1-ol.
| Compound Name | (E,1S)-4-fluoro-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 124567652 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (E,1S)-4-fluoro-1-phenylbut-3-en-1-ol |
| SMILES | O[C@@H](C/C=C/F)c1ccccc1 |
| InChI | InChI=1S/C10H11FO/c11-8-4-7-10(12)9-5-2-1-3-6-9/h1-6,8,10,12H,7H2/b8-4+/t10-/m0/s1 |
| InChIKey | JXYWJCDVAZIZOE-GOJXHPMJSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |