C16H24O2 — CID 134895948
(Z,1R,5R)-1-phenyldec-3-ene-1,5-diol (PubChem CID 134895948) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (Z,1R,5R)-1-phenyldec-3-ene-1,5-diol.
| Compound Name | (Z,1R,5R)-1-phenyldec-3-ene-1,5-diol |
|---|---|
| PubChem CID | 134895948 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (Z,1R,5R)-1-phenyldec-3-ene-1,5-diol |
| SMILES | CCCCC[C@@H](O)/C=C\C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-2-3-5-11-15(17)12-8-13-16(18)14-9-6-4-7-10-14/h4,6-10,12,15-18H,2-3,5,11,13H2,1H3/b12-8-/t15-,16-/m1/s1 |
| InChIKey | CPEJLINFPMQQKJ-YHTPHNNESA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|