About dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol
dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol (PubChem CID 69241764) has the molecular formula C17H30O4P+
and a molecular weight of 329.40 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol |
| PubChem CID | 69241764 |
| Molecular Formula | C17H30O4P+ |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol |
| SMILES | CCCCCCCCCCC(O)c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C17H28O.HO3P/c1-2-3-4-5-6-7-8-12-15-17(18)16-13-10-9-11-14-16;1-4(2)3/h9-11,13-14,17-18H,2-8,12,15H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | QRSNKQNNFJYWCQ-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol?
The IUPAC name of dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol (CID 69241764) is dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol.
What is the SMILES notation for dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol?
The canonical SMILES for dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol is CCCCCCCCCCC(O)c1ccccc1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol?
The InChIKey is QRSNKQNNFJYWCQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H28O.HO3P/c1-2-3-4-5-6-7-8-12-15-17(18)16-13-10-9-11-14-16;1-4(2)3/h9-11,13-14,17-18H,2-8,12,15H2,1H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol?
dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol has a molecular weight of 329.40 g/mol, XLogP of 4.88, 10 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;1-phenylundecan-1-ol is sourced from PubChem (CID 69241764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).