About phenylmethanol;1-phenylpentan-1-ol
phenylmethanol;1-phenylpentan-1-ol (PubChem CID 160862998) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is phenylmethanol;1-phenylpentan-1-ol.
Molecular Properties
| Compound Name | phenylmethanol;1-phenylpentan-1-ol |
| PubChem CID | 160862998 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | phenylmethanol;1-phenylpentan-1-ol |
| SMILES | CCCCC(O)c1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/C11H16O.C7H8O/c1-2-3-9-11(12)10-7-5-4-6-8-10;8-6-7-4-2-1-3-5-7/h4-8,11-12H,2-3,9H2,1H3;1-5,8H,6H2 |
| InChIKey | SKSUNGJDQYWGGK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenylmethanol;1-phenylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanol;1-phenylpentan-1-ol?
The IUPAC name of phenylmethanol;1-phenylpentan-1-ol (CID 160862998) is phenylmethanol;1-phenylpentan-1-ol.
What is the SMILES notation for phenylmethanol;1-phenylpentan-1-ol?
The canonical SMILES for phenylmethanol;1-phenylpentan-1-ol is CCCCC(O)c1ccccc1.OCc1ccccc1.
What is the InChIKey of phenylmethanol;1-phenylpentan-1-ol?
The InChIKey is SKSUNGJDQYWGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C7H8O/c1-2-3-9-11(12)10-7-5-4-6-8-10;8-6-7-4-2-1-3-5-7/h4-8,11-12H,2-3,9H2,1H3;1-5,8H,6H2.
What are the key properties of phenylmethanol;1-phenylpentan-1-ol?
phenylmethanol;1-phenylpentan-1-ol has a molecular weight of 272.39 g/mol, XLogP of 4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanol;1-phenylpentan-1-ol is sourced from PubChem (CID 160862998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).