C17H34O2 — CID 101453637
(E,7R,11R)-heptadec-8-ene-7,11-diol (PubChem CID 101453637) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is (E,7R,11R)-heptadec-8-ene-7,11-diol.
| Compound Name | (E,7R,11R)-heptadec-8-ene-7,11-diol |
|---|---|
| PubChem CID | 101453637 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (E,7R,11R)-heptadec-8-ene-7,11-diol |
| SMILES | CCCCCC[C@@H](O)C/C=C/[C@H](O)CCCCCC |
| InChI | InChI=1S/C17H34O2/c1-3-5-7-9-12-16(18)14-11-15-17(19)13-10-8-6-4-2/h11,14,16-19H,3-10,12-13,15H2,1-2H3/b14-11+/t16-,17-/m1/s1 |
| InChIKey | DVYWITMEKNFYMR-OMCKNOPTSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|