C11H16O2 — CID 13204353
(4R)-1-phenylpentane-1,4-diol (PubChem CID 13204353) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (4R)-1-phenylpentane-1,4-diol.
| Compound Name | (4R)-1-phenylpentane-1,4-diol |
|---|---|
| PubChem CID | 13204353 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (4R)-1-phenylpentane-1,4-diol |
| SMILES | C[C@@H](O)CCC(O)c1ccccc1 |
| InChI | InChI=1S/C11H16O2/c1-9(12)7-8-11(13)10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3/t9-,11?/m1/s1 |
| InChIKey | CLCWBIKVZDPOPD-BFHBGLAWSA-N |
| XLogP | 1.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |