C12H18O3 — CID 81134047
1-(3-methoxyphenyl)pentane-1,4-diol (PubChem CID 81134047) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)pentane-1,4-diol.
| Compound Name | 1-(3-methoxyphenyl)pentane-1,4-diol |
|---|---|
| PubChem CID | 81134047 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(3-methoxyphenyl)pentane-1,4-diol |
| SMILES | COc1cccc(C(O)CCC(C)O)c1 |
| InChI | InChI=1S/C12H18O3/c1-9(13)6-7-12(14)10-4-3-5-11(8-10)15-2/h3-5,8-9,12-14H,6-7H2,1-2H3 |
| InChIKey | MULIOSUHLJWTLX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |