About 1-phenylpropane-1,3-diol;hydrobromide
1-phenylpropane-1,3-diol;hydrobromide (PubChem CID 68975268) has the molecular formula C9H13BrO2
and a molecular weight of 233.10 g/mol. Its IUPAC name is 1-phenylpropane-1,3-diol;hydrobromide.
Molecular Properties
| Compound Name | 1-phenylpropane-1,3-diol;hydrobromide |
| PubChem CID | 68975268 |
| Molecular Formula | C9H13BrO2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1-phenylpropane-1,3-diol;hydrobromide |
| SMILES | Br.OCCC(O)c1ccccc1 |
| InChI | InChI=1S/C9H12O2.BrH/c10-7-6-9(11)8-4-2-1-3-5-8;/h1-5,9-11H,6-7H2;1H |
| InChIKey | NKSCPAPVHNATMI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropane-1,3-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropane-1,3-diol;hydrobromide?
The IUPAC name of 1-phenylpropane-1,3-diol;hydrobromide (CID 68975268) is 1-phenylpropane-1,3-diol;hydrobromide.
What is the SMILES notation for 1-phenylpropane-1,3-diol;hydrobromide?
The canonical SMILES for 1-phenylpropane-1,3-diol;hydrobromide is Br.OCCC(O)c1ccccc1.
What is the InChIKey of 1-phenylpropane-1,3-diol;hydrobromide?
The InChIKey is NKSCPAPVHNATMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.BrH/c10-7-6-9(11)8-4-2-1-3-5-8;/h1-5,9-11H,6-7H2;1H.
What are the key properties of 1-phenylpropane-1,3-diol;hydrobromide?
1-phenylpropane-1,3-diol;hydrobromide has a molecular weight of 233.10 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropane-1,3-diol;hydrobromide is sourced from PubChem (CID 68975268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).