C9H11IO2 — CID 71066511
(1S)-1-(4-iodophenyl)propane-1,3-diol (PubChem CID 71066511) has the molecular formula C9H11IO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is (1S)-1-(4-iodophenyl)propane-1,3-diol.
| Compound Name | (1S)-1-(4-iodophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 71066511 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | (1S)-1-(4-iodophenyl)propane-1,3-diol |
| SMILES | OCC[C@H](O)c1ccc(I)cc1 |
| InChI | InChI=1S/C9H11IO2/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4,9,11-12H,5-6H2/t9-/m0/s1 |
| InChIKey | NEHLLQYZGQJVJJ-VIFPVBQESA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|