C15H21NO2P2 — CID 145407356
diphospazane;1-(4-phenylphenyl)propane-1,3-diol (PubChem CID 145407356) has the molecular formula C15H21NO2P2 and a molecular weight of 309.29 g/mol. Its IUPAC name is diphospazane;1-(4-phenylphenyl)propane-1,3-diol.
| Compound Name | diphospazane;1-(4-phenylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 145407356 |
| Molecular Formula | C15H21NO2P2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | diphospazane;1-(4-phenylphenyl)propane-1,3-diol |
| SMILES | OCCC(O)c1ccc(-c2ccccc2)cc1.PNP |
| InChI | InChI=1S/C15H16O2.H5NP2/c16-11-10-15(17)14-8-6-13(7-9-14)12-4-2-1-3-5-12;2-1-3/h1-9,15-17H,10-11H2;1H,2-3H2 |
| InChIKey | SYIIIZAWPNJVPJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|