C16H18O3 — CID 171873101
1-(4-phenylphenyl)butane-1,2,4-triol (PubChem CID 171873101) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(4-phenylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-phenylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873101 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-(4-phenylphenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18O3/c17-11-10-15(18)16(19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-19H,10-11H2 |
| InChIKey | LRIBXJRGNNRZCQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |