C13H16N2O3 — CID 171873055
1-(5-phenyl-1H-pyrazol-4-yl)butane-1,2,4-triol (PubChem CID 171873055) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(5-phenyl-1H-pyrazol-4-yl)butane-1,2,4-triol.
| Compound Name | 1-(5-phenyl-1H-pyrazol-4-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873055 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(5-phenyl-1H-pyrazol-4-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3/c16-7-6-11(17)13(18)10-8-14-15-12(10)9-4-2-1-3-5-9/h1-5,8,11,13,16-18H,6-7H2,(H,14,15) |
| InChIKey | GSEPCYMADXMAOC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |