C18H22N2O — CID 106651340
[(1E)-cycloocten-1-yl]-(5-phenyl-1H-pyrazol-4-yl)methanol (PubChem CID 106651340) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-(5-phenyl-1H-pyrazol-4-yl)methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-(5-phenyl-1H-pyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 106651340 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-(5-phenyl-1H-pyrazol-4-yl)methanol |
| SMILES | OC(/C1=C/CCCCCC1)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c21-18(15-11-5-2-1-3-6-12-15)16-13-19-20-17(16)14-9-7-4-8-10-14/h4,7-11,13,18,21H,1-3,5-6,12H2,(H,19,20)/b15-11+ |
| InChIKey | AYHAKGAFCPARJR-RVDMUPIBSA-N |
| XLogP | 4.39 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|