C10H14N2O — CID 114988921
cyclohexen-1-yl(1H-pyrazol-5-yl)methanol (PubChem CID 114988921) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is cyclohexen-1-yl(1H-pyrazol-5-yl)methanol.
| Compound Name | cyclohexen-1-yl(1H-pyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114988921 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | cyclohexen-1-yl(1H-pyrazol-5-yl)methanol |
| SMILES | OC(C1=CCCCC1)c1ccn[nH]1 |
| InChI | InChI=1S/C10H14N2O/c13-10(9-6-7-11-12-9)8-4-2-1-3-5-8/h4,6-7,10,13H,1-3,5H2,(H,11,12) |
| InChIKey | GDMHEHNHXINUBX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|