C10H13NOS — CID 106651555
cyclohexen-1-yl(1,3-thiazol-5-yl)methanol (PubChem CID 106651555) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is cyclohexen-1-yl(1,3-thiazol-5-yl)methanol.
| Compound Name | cyclohexen-1-yl(1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 106651555 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | cyclohexen-1-yl(1,3-thiazol-5-yl)methanol |
| SMILES | OC(C1=CCCCC1)c1cncs1 |
| InChI | InChI=1S/C10H13NOS/c12-10(9-6-11-7-13-9)8-4-2-1-3-5-8/h4,6-7,10,12H,1-3,5H2 |
| InChIKey | DQQIENLQFDDUFG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|