C14H22N2S — CID 106654007
N-[cycloocten-1-yl(1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 106654007) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-[cycloocten-1-yl(1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | N-[cycloocten-1-yl(1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106654007 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-[cycloocten-1-yl(1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCCC1)c1cncs1 |
| InChI | InChI=1S/C14H22N2S/c1-2-16-14(13-10-15-11-17-13)12-8-6-4-3-5-7-9-12/h8,10-11,14,16H,2-7,9H2,1H3 |
| InChIKey | XACXPOZRPZFQJR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|