C18H26BrN — CID 106654741
N-[(4-bromo-3,5-dimethylphenyl)-(cyclohepten-1-yl)methyl]ethanamine (PubChem CID 106654741) has the molecular formula C18H26BrN and a molecular weight of 336.32 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethylphenyl)-(cyclohepten-1-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3,5-dimethylphenyl)-(cyclohepten-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106654741 |
| Molecular Formula | C18H26BrN |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(4-bromo-3,5-dimethylphenyl)-(cyclohepten-1-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C18H26BrN/c1-4-20-18(15-9-7-5-6-8-10-15)16-11-13(2)17(19)14(3)12-16/h9,11-12,18,20H,4-8,10H2,1-3H3 |
| InChIKey | KMCBHECMBAAJID-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|