C15H20BrN — CID 81471848
N-[(3-bromo-4-methylphenyl)-(cyclopenten-1-yl)methyl]ethanamine (PubChem CID 81471848) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)-(cyclopenten-1-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-methylphenyl)-(cyclopenten-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81471848 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)-(cyclopenten-1-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCC1)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C15H20BrN/c1-3-17-15(12-6-4-5-7-12)13-9-8-11(2)14(16)10-13/h6,8-10,15,17H,3-5,7H2,1-2H3 |
| InChIKey | BXVGHOMITWDIOX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|