C20H31N — CID 106656476
N-[cycloocten-1-yl-(2,4,6-trimethylphenyl)methyl]ethanamine (PubChem CID 106656476) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[cycloocten-1-yl-(2,4,6-trimethylphenyl)methyl]ethanamine.
| Compound Name | N-[cycloocten-1-yl-(2,4,6-trimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106656476 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-[cycloocten-1-yl-(2,4,6-trimethylphenyl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCCC1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H31N/c1-5-21-20(18-11-9-7-6-8-10-12-18)19-16(3)13-15(2)14-17(19)4/h11,13-14,20-21H,5-10,12H2,1-4H3 |
| InChIKey | YMUFOMKLIONZKC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|