C16H23N — CID 55034558
N-[cyclohexen-1-yl-(2-methylphenyl)methyl]ethanamine (PubChem CID 55034558) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(2-methylphenyl)methyl]ethanamine.
| Compound Name | N-[cyclohexen-1-yl-(2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 55034558 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[cyclohexen-1-yl-(2-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)c1ccccc1C |
| InChI | InChI=1S/C16H23N/c1-3-17-16(14-10-5-4-6-11-14)15-12-8-7-9-13(15)2/h7-10,12,16-17H,3-6,11H2,1-2H3 |
| InChIKey | OPQWVQGCRMVFFE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|