C17H24BrN — CID 107982008
N-[(2-bromo-3-methylphenyl)-(cyclohexen-1-yl)methyl]propan-1-amine (PubChem CID 107982008) has the molecular formula C17H24BrN and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[(2-bromo-3-methylphenyl)-(cyclohexen-1-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromo-3-methylphenyl)-(cyclohexen-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107982008 |
| Molecular Formula | C17H24BrN |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(2-bromo-3-methylphenyl)-(cyclohexen-1-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCC1)c1cccc(C)c1Br |
| InChI | InChI=1S/C17H24BrN/c1-3-12-19-17(14-9-5-4-6-10-14)15-11-7-8-13(2)16(15)18/h7-9,11,17,19H,3-6,10,12H2,1-2H3 |
| InChIKey | TUXHPOMWVGRYPD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|