C19H28BrN — CID 106656754
N-[(3-bromo-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine (PubChem CID 106656754) has the molecular formula C19H28BrN and a molecular weight of 350.34 g/mol. Its IUPAC name is N-[(3-bromo-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106656754 |
| Molecular Formula | C19H28BrN |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(3-bromo-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine |
| SMILES | CCCNC(/C1=C/CCCCCC1)c1cccc(Br)c1C |
| InChI | InChI=1S/C19H28BrN/c1-3-14-21-19(16-10-7-5-4-6-8-11-16)17-12-9-13-18(20)15(17)2/h9-10,12-13,19,21H,3-8,11,14H2,1-2H3/b16-10+ |
| InChIKey | XLBCIIIBYXGBOM-MHWRWJLKSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|