C14H21NO — CID 62078327
N-[cyclohexen-1-yl-(3-methylfuran-2-yl)methyl]ethanamine (PubChem CID 62078327) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(3-methylfuran-2-yl)methyl]ethanamine.
| Compound Name | N-[cyclohexen-1-yl-(3-methylfuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62078327 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[cyclohexen-1-yl-(3-methylfuran-2-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)c1occc1C |
| InChI | InChI=1S/C14H21NO/c1-3-15-13(12-7-5-4-6-8-12)14-11(2)9-10-16-14/h7,9-10,13,15H,3-6,8H2,1-2H3 |
| InChIKey | MIYPJVURTJJTML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|