C18H26ClN — CID 106656210
N-[(5-chloro-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine (PubChem CID 106656210) has the molecular formula C18H26ClN and a molecular weight of 291.87 g/mol. Its IUPAC name is N-[(5-chloro-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine.
| Compound Name | N-[(5-chloro-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106656210 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[(5-chloro-2-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
| SMILES | CCNC(/C1=C/CCCCCC1)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C18H26ClN/c1-3-20-18(15-9-7-5-4-6-8-10-15)17-13-16(19)12-11-14(17)2/h9,11-13,18,20H,3-8,10H2,1-2H3/b15-9+ |
| InChIKey | BHKHAJDGYGZHFX-OQLLNIDSSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|