C17H22ClF2N — CID 106656364
N-[(4-chloro-2,5-difluorophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine (PubChem CID 106656364) has the molecular formula C17H22ClF2N and a molecular weight of 313.82 g/mol. Its IUPAC name is N-[(4-chloro-2,5-difluorophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine.
| Compound Name | N-[(4-chloro-2,5-difluorophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106656364 |
| Molecular Formula | C17H22ClF2N |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[(4-chloro-2,5-difluorophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
| SMILES | CCNC(/C1=C/CCCCCC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C17H22ClF2N/c1-2-21-17(12-8-6-4-3-5-7-9-12)13-10-16(20)14(18)11-15(13)19/h8,10-11,17,21H,2-7,9H2,1H3/b12-8+ |
| InChIKey | CWIOVZKFQJPHOC-XYOKQWHBSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|