C17H23ClIN — CID 106656144
N-[(3-chloro-4-iodophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine (PubChem CID 106656144) has the molecular formula C17H23ClIN and a molecular weight of 403.74 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106656144 |
| Molecular Formula | C17H23ClIN |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-[(1E)-cycloocten-1-yl]methyl]ethanamine |
| SMILES | CCNC(/C1=C/CCCCCC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C17H23ClIN/c1-2-20-17(13-8-6-4-3-5-7-9-13)14-10-11-16(19)15(18)12-14/h8,10-12,17,20H,2-7,9H2,1H3/b13-8+ |
| InChIKey | HWDHUJAIHXAOLV-MDWZMJQESA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|