C15H19ClIN — CID 103220292
N-[(3-chloro-4-iodophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine (PubChem CID 103220292) has the molecular formula C15H19ClIN and a molecular weight of 375.68 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103220292 |
| Molecular Formula | C15H19ClIN |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClIN/c1-2-9-18-15(11-5-3-4-6-11)12-7-8-14(17)13(16)10-12/h5,7-8,10,15,18H,2-4,6,9H2,1H3 |
| InChIKey | YQKGLZQKZPMQEH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|