C18H21ClIN — CID 103214844
N-[(3-chloro-4-iodophenyl)-(2,5-dimethylphenyl)methyl]propan-1-amine (PubChem CID 103214844) has the molecular formula C18H21ClIN and a molecular weight of 413.73 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(2,5-dimethylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(2,5-dimethylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103214844 |
| Molecular Formula | C18H21ClIN |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(2,5-dimethylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)c(Cl)c1)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H21ClIN/c1-4-9-21-18(14-7-8-17(20)16(19)11-14)15-10-12(2)5-6-13(15)3/h5-8,10-11,18,21H,4,9H2,1-3H3 |
| InChIKey | YOKYOZQMQWPQMX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|