C12H17ClIN — CID 103214498
1-(3-chloro-4-iodophenyl)-N-propylpropan-1-amine (PubChem CID 103214498) has the molecular formula C12H17ClIN and a molecular weight of 337.63 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-N-propylpropan-1-amine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 103214498 |
| Molecular Formula | C12H17ClIN |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClIN/c1-3-7-15-12(4-2)9-5-6-11(14)10(13)8-9/h5-6,8,12,15H,3-4,7H2,1-2H3 |
| InChIKey | QIRZGLRSIGFIPY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|