C18H21Cl2N — CID 114879199
1-[4-(3,5-dichlorophenyl)phenyl]-N-propylpropan-1-amine (PubChem CID 114879199) has the molecular formula C18H21Cl2N and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-[4-(3,5-dichlorophenyl)phenyl]-N-propylpropan-1-amine.
| Compound Name | 1-[4-(3,5-dichlorophenyl)phenyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114879199 |
| Molecular Formula | C18H21Cl2N |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[4-(3,5-dichlorophenyl)phenyl]-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1ccc(-c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21Cl2N/c1-3-9-21-18(4-2)14-7-5-13(6-8-14)15-10-16(19)12-17(20)11-15/h5-8,10-12,18,21H,3-4,9H2,1-2H3 |
| InChIKey | JZRPLEHNNNSQKI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |