C16H19ClINS — CID 103220153
N-[(3-chloro-4-iodophenyl)-(5-ethylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 103220153) has the molecular formula C16H19ClINS and a molecular weight of 419.76 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(5-ethylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(5-ethylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103220153 |
| Molecular Formula | C16H19ClINS |
| Molecular Weight | 419.76 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(5-ethylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)c(Cl)c1)c1ccc(CC)s1 |
| InChI | InChI=1S/C16H19ClINS/c1-3-9-19-16(15-8-6-12(4-2)20-15)11-5-7-14(18)13(17)10-11/h5-8,10,16,19H,3-4,9H2,1-2H3 |
| InChIKey | ALYUMJQFQDUPQH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|