C16H19ClINS — CID 103215285
1-(3-chloro-4-iodophenyl)-N-propyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 103215285) has the molecular formula C16H19ClINS and a molecular weight of 419.76 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-N-propyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 103215285 |
| Molecular Formula | C16H19ClINS |
| Molecular Weight | 419.76 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCCNC(CCc1ccsc1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C16H19ClINS/c1-2-8-19-16(6-3-12-7-9-20-11-12)13-4-5-15(18)14(17)10-13/h4-5,7,9-11,16,19H,2-3,6,8H2,1H3 |
| InChIKey | GRJRTLUUUMAFGF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|