C15H19ClN2S — CID 103444845
1-(3-chloro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 103444845) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 103444845 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCCNC(CCc1ccsc1)c1ncccc1Cl |
| InChI | InChI=1S/C15H19ClN2S/c1-2-8-17-14(6-5-12-7-10-19-11-12)15-13(16)4-3-9-18-15/h3-4,7,9-11,14,17H,2,5-6,8H2,1H3 |
| InChIKey | ODFHPLJMQVQIDQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |