C15H19FN2S — CID 79713195
1-(5-fluoro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 79713195) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 79713195 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCCNC(CCc1ccsc1)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H19FN2S/c1-2-8-17-14(5-3-12-7-9-19-11-12)15-6-4-13(16)10-18-15/h4,6-7,9-11,14,17H,2-3,5,8H2,1H3 |
| InChIKey | UUXMUEUQLIDZDR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |