C15H26FN3O2 — CID 83109308
2-[[3-(5-fluoro-2-pyridinyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 83109308) has the molecular formula C15H26FN3O2 and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-[[3-(5-fluoro-2-pyridinyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[3-(5-fluoro-2-pyridinyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 83109308 |
| Molecular Formula | C15H26FN3O2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[[3-(5-fluoro-2-pyridinyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCNC(CCN(CCO)CCO)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H26FN3O2/c1-2-6-17-15(14-4-3-13(16)12-18-14)5-7-19(8-10-20)9-11-21/h3-4,12,15,17,20-21H,2,5-11H2,1H3 |
| InChIKey | NRMFELXUQFMSOW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |