C16H27FN2O2 — CID 62643290
2-[[3-(3-fluorophenyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 62643290) has the molecular formula C16H27FN2O2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-[[3-(3-fluorophenyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[3-(3-fluorophenyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 62643290 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[[3-(3-fluorophenyl)-3-(propylamino)propyl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCNC(CCN(CCO)CCO)c1cccc(F)c1 |
| InChI | InChI=1S/C16H27FN2O2/c1-2-7-18-16(14-4-3-5-15(17)13-14)6-8-19(9-11-20)10-12-21/h3-5,13,16,18,20-21H,2,6-12H2,1H3 |
| InChIKey | BKHLBCZSVWGDAT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |