C15H25FN2O2 — CID 62643636
2-[[3-(ethylamino)-3-(4-fluorophenyl)propyl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 62643636) has the molecular formula C15H25FN2O2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-[[3-(ethylamino)-3-(4-fluorophenyl)propyl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[3-(ethylamino)-3-(4-fluorophenyl)propyl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 62643636 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[[3-(ethylamino)-3-(4-fluorophenyl)propyl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCNC(CCN(CCO)CCO)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H25FN2O2/c1-2-17-15(13-3-5-14(16)6-4-13)7-8-18(9-11-19)10-12-20/h3-6,15,17,19-20H,2,7-12H2,1H3 |
| InChIKey | LUAUMTYUAPNWGU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |