C16H28FN3O — CID 83111687
2-[butyl-[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]amino]ethanol (PubChem CID 83111687) has the molecular formula C16H28FN3O and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-[butyl-[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]amino]ethanol.
| Compound Name | 2-[butyl-[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]amino]ethanol |
|---|---|
| PubChem CID | 83111687 |
| Molecular Formula | C16H28FN3O |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-[butyl-[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]amino]ethanol |
| SMILES | CCCCN(CCO)CCC(NCC)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H28FN3O/c1-3-5-9-20(11-12-21)10-8-16(18-4-2)15-7-6-14(17)13-19-15/h6-7,13,16,18,21H,3-5,8-12H2,1-2H3 |
| InChIKey | FJLJHBLGADCLHM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |