C15H26FN3O — CID 107204696
5-[[3-(5-fluoro-2-pyridinyl)-3-(methylamino)propyl]-methylamino]pentan-1-ol (PubChem CID 107204696) has the molecular formula C15H26FN3O and a molecular weight of 283.39 g/mol. Its IUPAC name is 5-[[3-(5-fluoro-2-pyridinyl)-3-(methylamino)propyl]-methylamino]pentan-1-ol.
| Compound Name | 5-[[3-(5-fluoro-2-pyridinyl)-3-(methylamino)propyl]-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107204696 |
| Molecular Formula | C15H26FN3O |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 5-[[3-(5-fluoro-2-pyridinyl)-3-(methylamino)propyl]-methylamino]pentan-1-ol |
| SMILES | CNC(CCN(C)CCCCCO)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H26FN3O/c1-17-14(15-7-6-13(16)12-18-15)8-10-19(2)9-4-3-5-11-20/h6-7,12,14,17,20H,3-5,8-11H2,1-2H3 |
| InChIKey | MYVPEXJQGLULEB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|