C14H24FN3O — CID 83126298
1-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]-methylamino]propan-2-ol (PubChem CID 83126298) has the molecular formula C14H24FN3O and a molecular weight of 269.36 g/mol. Its IUPAC name is 1-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]-methylamino]propan-2-ol.
| Compound Name | 1-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 83126298 |
| Molecular Formula | C14H24FN3O |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)propyl]-methylamino]propan-2-ol |
| SMILES | CCNC(CCN(C)CC(C)O)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H24FN3O/c1-4-16-14(7-8-18(3)10-11(2)19)13-6-5-12(15)9-17-13/h5-6,9,11,14,16,19H,4,7-8,10H2,1-3H3 |
| InChIKey | XZEZDKOXXZKSRD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |