C15H26FN3O — CID 104554713
2-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)-2-methylpropyl]-methylamino]propan-1-ol (PubChem CID 104554713) has the molecular formula C15H26FN3O and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)-2-methylpropyl]-methylamino]propan-1-ol.
| Compound Name | 2-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)-2-methylpropyl]-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 104554713 |
| Molecular Formula | C15H26FN3O |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-[[3-(ethylamino)-3-(5-fluoro-2-pyridinyl)-2-methylpropyl]-methylamino]propan-1-ol |
| SMILES | CCNC(c1ccc(F)cn1)C(C)CN(C)C(C)CO |
| InChI | InChI=1S/C15H26FN3O/c1-5-17-15(14-7-6-13(16)8-18-14)11(2)9-19(4)12(3)10-20/h6-8,11-12,15,17,20H,5,9-10H2,1-4H3 |
| InChIKey | MAABDXJFSVJUJC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |